C20H23N2O5PS — CID 5299506
2-(1,3-benzoxazol-2-ylsulfanyl)-N-[4-(diethoxyphosphorylmethyl)phenyl]acetamide (PubChem CID 5299506) has the molecular formula C20H23N2O5PS and a molecular weight of 434.45 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[4-(diethoxyphosphorylmethyl)phenyl]acetamide.
| Compound Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[4-(diethoxyphosphorylmethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 5299506 |
| Molecular Formula | C20H23N2O5PS |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[4-(diethoxyphosphorylmethyl)phenyl]acetamide |
| SMILES | CCOP(=O)(Cc1ccc(NC(=O)CSc2nc3ccccc3o2)cc1)OCC |
| InChI | InChI=1S/C20H23N2O5PS/c1-3-25-28(24,26-4-2)13-15-9-11-16(12-10-15)21-19(23)14-29-20-22-17-7-5-6-8-18(17)27-20/h5-12H,3-4,13-14H2,1-2H3,(H,21,23) |
| InChIKey | YECQPMNIJPLVJY-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|