C23H20N2O4 — CID 7741918
4-(2-oxo-1,3-benzoxazol-3-yl)-N-(4-phenoxyphenyl)butanamide (PubChem CID 7741918) has the molecular formula C23H20N2O4 and a molecular weight of 388.42 g/mol. Its IUPAC name is 4-(2-oxo-1,3-benzoxazol-3-yl)-N-(4-phenoxyphenyl)butanamide.
| Compound Name | 4-(2-oxo-1,3-benzoxazol-3-yl)-N-(4-phenoxyphenyl)butanamide |
|---|---|
| PubChem CID | 7741918 |
| Molecular Formula | C23H20N2O4 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 4-(2-oxo-1,3-benzoxazol-3-yl)-N-(4-phenoxyphenyl)butanamide |
| SMILES | O=C(CCCn1c(=O)oc2ccccc21)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C23H20N2O4/c26-22(11-6-16-25-20-9-4-5-10-21(20)29-23(25)27)24-17-12-14-19(15-13-17)28-18-7-2-1-3-8-18/h1-5,7-10,12-15H,6,11,16H2,(H,24,26) |
| InChIKey | SHDAOKZRTQAQKU-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |