C22H19N3O4 — CID 43068531
4-(2-oxo-1,3-benzoxazol-3-yl)-N-(2-phenoxy-3-pyridinyl)butanamide (PubChem CID 43068531) has the molecular formula C22H19N3O4 and a molecular weight of 389.41 g/mol. Its IUPAC name is 4-(2-oxo-1,3-benzoxazol-3-yl)-N-(2-phenoxy-3-pyridinyl)butanamide.
| Compound Name | 4-(2-oxo-1,3-benzoxazol-3-yl)-N-(2-phenoxy-3-pyridinyl)butanamide |
|---|---|
| PubChem CID | 43068531 |
| Molecular Formula | C22H19N3O4 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 4-(2-oxo-1,3-benzoxazol-3-yl)-N-(2-phenoxy-3-pyridinyl)butanamide |
| SMILES | O=C(CCCn1c(=O)oc2ccccc21)Nc1cccnc1Oc1ccccc1 |
| InChI | InChI=1S/C22H19N3O4/c26-20(13-7-15-25-18-11-4-5-12-19(18)29-22(25)27)24-17-10-6-14-23-21(17)28-16-8-2-1-3-9-16/h1-6,8-12,14H,7,13,15H2,(H,24,26) |
| InChIKey | LRRRKWZEORACIC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |