C24H21N3O5 — CID 55661422
4-(1,3-dioxoisoindol-2-yl)-N-[2-(4-methoxyphenoxy)-3-pyridinyl]butanamide (PubChem CID 55661422) has the molecular formula C24H21N3O5 and a molecular weight of 431.45 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-N-[2-(4-methoxyphenoxy)-3-pyridinyl]butanamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-N-[2-(4-methoxyphenoxy)-3-pyridinyl]butanamide |
|---|---|
| PubChem CID | 55661422 |
| Molecular Formula | C24H21N3O5 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-N-[2-(4-methoxyphenoxy)-3-pyridinyl]butanamide |
| SMILES | COc1ccc(Oc2ncccc2NC(=O)CCCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C24H21N3O5/c1-31-16-10-12-17(13-11-16)32-22-20(8-4-14-25-22)26-21(28)9-5-15-27-23(29)18-6-2-3-7-19(18)24(27)30/h2-4,6-8,10-14H,5,9,15H2,1H3,(H,26,28) |
| InChIKey | VGUWUQFBKSHZJS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|