C23H18ClN3O6 — CID 24529865
N-[4-(2-chlorophenoxy)phenyl]-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide (PubChem CID 24529865) has the molecular formula C23H18ClN3O6 and a molecular weight of 467.87 g/mol. Its IUPAC name is N-[4-(2-chlorophenoxy)phenyl]-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide.
| Compound Name | N-[4-(2-chlorophenoxy)phenyl]-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide |
|---|---|
| PubChem CID | 24529865 |
| Molecular Formula | C23H18ClN3O6 |
| Molecular Weight | 467.87 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | N-[4-(2-chlorophenoxy)phenyl]-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide |
| SMILES | O=C(CCCn1c(=O)oc2cc([N+](=O)[O-])ccc21)Nc1ccc(Oc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C23H18ClN3O6/c24-18-4-1-2-5-20(18)32-17-10-7-15(8-11-17)25-22(28)6-3-13-26-19-12-9-16(27(30)31)14-21(19)33-23(26)29/h1-2,4-5,7-12,14H,3,6,13H2,(H,25,28) |
| InChIKey | GHAJIJJKAXIWIR-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.87 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|