C20H17N5O5 — CID 37193877
N-(4-imidazol-1-ylphenyl)-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide (PubChem CID 37193877) has the molecular formula C20H17N5O5 and a molecular weight of 407.39 g/mol. Its IUPAC name is N-(4-imidazol-1-ylphenyl)-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide.
| Compound Name | N-(4-imidazol-1-ylphenyl)-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide |
|---|---|
| PubChem CID | 37193877 |
| Molecular Formula | C20H17N5O5 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | N-(4-imidazol-1-ylphenyl)-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide |
| SMILES | O=C(CCCn1c(=O)oc2cc([N+](=O)[O-])ccc21)Nc1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C20H17N5O5/c26-19(22-14-3-5-15(6-4-14)23-11-9-21-13-23)2-1-10-24-17-8-7-16(25(28)29)12-18(17)30-20(24)27/h3-9,11-13H,1-2,10H2,(H,22,26) |
| InChIKey | HSSLKIQOBOLZQJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|