C14H12N4O5S — CID 9043748
4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-(1,3-thiazol-2-yl)butanamide (PubChem CID 9043748) has the molecular formula C14H12N4O5S and a molecular weight of 348.34 g/mol. Its IUPAC name is 4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-(1,3-thiazol-2-yl)butanamide.
| Compound Name | 4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-(1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 9043748 |
| Molecular Formula | C14H12N4O5S |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-(1,3-thiazol-2-yl)butanamide |
| SMILES | O=C(CCCn1c(=O)oc2cc([N+](=O)[O-])ccc21)Nc1nccs1 |
| InChI | InChI=1S/C14H12N4O5S/c19-12(16-13-15-5-7-24-13)2-1-6-17-10-4-3-9(18(21)22)8-11(10)23-14(17)20/h3-5,7-8H,1-2,6H2,(H,15,16,19) |
| InChIKey | DPIOYARLALOCCT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 120.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|