C19H13F3N4O6S — CID 27899380
4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]butanamide (PubChem CID 27899380) has the molecular formula C19H13F3N4O6S and a molecular weight of 482.40 g/mol. Its IUPAC name is 4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]butanamide.
| Compound Name | 4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 27899380 |
| Molecular Formula | C19H13F3N4O6S |
| Molecular Weight | 482.40 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | 4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]butanamide |
| SMILES | O=C(CCCn1c(=O)oc2cc([N+](=O)[O-])ccc21)Nc1nc2ccc(OC(F)(F)F)cc2s1 |
| InChI | InChI=1S/C19H13F3N4O6S/c20-19(21,22)32-11-4-5-12-15(9-11)33-17(23-12)24-16(27)2-1-7-25-13-6-3-10(26(29)30)8-14(13)31-18(25)28/h3-6,8-9H,1-2,7H2,(H,23,24,27) |
| InChIKey | KBRRYRLFIYSWSB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 129.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|