C24H18N4O5S — CID 34054520
N-[3-(1,3-benzothiazol-2-yl)phenyl]-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide (PubChem CID 34054520) has the molecular formula C24H18N4O5S and a molecular weight of 474.50 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)phenyl]-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide |
|---|---|
| PubChem CID | 34054520 |
| Molecular Formula | C24H18N4O5S |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide |
| SMILES | O=C(CCCn1c(=O)oc2cc([N+](=O)[O-])ccc21)Nc1cccc(-c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C24H18N4O5S/c29-22(9-4-12-27-19-11-10-17(28(31)32)14-20(19)33-24(27)30)25-16-6-3-5-15(13-16)23-26-18-7-1-2-8-21(18)34-23/h1-3,5-8,10-11,13-14H,4,9,12H2,(H,25,29) |
| InChIKey | LZJMJGVFDMEJGA-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 120.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|