C20H17N5O5 — CID 55537149
4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-(1-phenylpyrazol-3-yl)butanamide (PubChem CID 55537149) has the molecular formula C20H17N5O5 and a molecular weight of 407.39 g/mol. Its IUPAC name is 4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-(1-phenylpyrazol-3-yl)butanamide.
| Compound Name | 4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-(1-phenylpyrazol-3-yl)butanamide |
|---|---|
| PubChem CID | 55537149 |
| Molecular Formula | C20H17N5O5 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-(1-phenylpyrazol-3-yl)butanamide |
| SMILES | O=C(CCCn1c(=O)oc2cc([N+](=O)[O-])ccc21)Nc1ccn(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H17N5O5/c26-19(21-18-10-12-24(22-18)14-5-2-1-3-6-14)7-4-11-23-16-9-8-15(25(28)29)13-17(16)30-20(23)27/h1-3,5-6,8-10,12-13H,4,7,11H2,(H,21,22,26) |
| InChIKey | UFUVYKOMYXGSBS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|