C18H16ClN3O5 — CID 9209788
N-[(2-chlorophenyl)methyl]-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide (PubChem CID 9209788) has the molecular formula C18H16ClN3O5 and a molecular weight of 389.80 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide |
|---|---|
| PubChem CID | 9209788 |
| Molecular Formula | C18H16ClN3O5 |
| Molecular Weight | 389.80 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide |
| SMILES | O=C(CCCn1c(=O)oc2cc([N+](=O)[O-])ccc21)NCc1ccccc1Cl |
| InChI | InChI=1S/C18H16ClN3O5/c19-14-5-2-1-4-12(14)11-20-17(23)6-3-9-21-15-8-7-13(22(25)26)10-16(15)27-18(21)24/h1-2,4-5,7-8,10H,3,6,9,11H2,(H,20,23) |
| InChIKey | CVGORSMTTKBXFV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.80 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|