C16H20N4O6 — CID 18162823
4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-[2-oxo-2-(propylamino)ethyl]butanamide (PubChem CID 18162823) has the molecular formula C16H20N4O6 and a molecular weight of 364.36 g/mol. Its IUPAC name is 4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-[2-oxo-2-(propylamino)ethyl]butanamide.
| Compound Name | 4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-[2-oxo-2-(propylamino)ethyl]butanamide |
|---|---|
| PubChem CID | 18162823 |
| Molecular Formula | C16H20N4O6 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-[2-oxo-2-(propylamino)ethyl]butanamide |
| SMILES | CCCNC(=O)CNC(=O)CCCn1c(=O)oc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C16H20N4O6/c1-2-7-17-15(22)10-18-14(21)4-3-8-19-12-6-5-11(20(24)25)9-13(12)26-16(19)23/h5-6,9H,2-4,7-8,10H2,1H3,(H,17,22)(H,18,21) |
| InChIKey | JZILQONYRMRMBO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 136.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|