C18H22N4O6 — CID 18157167
4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-(3-oxo-3-pyrrolidin-1-ylpropyl)butanamide (PubChem CID 18157167) has the molecular formula C18H22N4O6 and a molecular weight of 390.40 g/mol. Its IUPAC name is 4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-(3-oxo-3-pyrrolidin-1-ylpropyl)butanamide.
| Compound Name | 4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-(3-oxo-3-pyrrolidin-1-ylpropyl)butanamide |
|---|---|
| PubChem CID | 18157167 |
| Molecular Formula | C18H22N4O6 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-(3-oxo-3-pyrrolidin-1-ylpropyl)butanamide |
| SMILES | O=C(CCCn1c(=O)oc2cc([N+](=O)[O-])ccc21)NCCC(=O)N1CCCC1 |
| InChI | InChI=1S/C18H22N4O6/c23-16(19-8-7-17(24)20-9-1-2-10-20)4-3-11-21-14-6-5-13(22(26)27)12-15(14)28-18(21)25/h5-6,12H,1-4,7-11H2,(H,19,23) |
| InChIKey | QEMHMDIIZBCAEF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 127.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|