C23H24N4O6 — CID 39566728
3-[4-[4-(4-methylbenzoyl)piperazin-1-yl]-4-oxobutyl]-6-nitro-1,3-benzoxazol-2-one (PubChem CID 39566728) has the molecular formula C23H24N4O6 and a molecular weight of 452.47 g/mol. Its IUPAC name is 3-[4-[4-(4-methylbenzoyl)piperazin-1-yl]-4-oxobutyl]-6-nitro-1,3-benzoxazol-2-one.
| Compound Name | 3-[4-[4-(4-methylbenzoyl)piperazin-1-yl]-4-oxobutyl]-6-nitro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 39566728 |
| Molecular Formula | C23H24N4O6 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 3-[4-[4-(4-methylbenzoyl)piperazin-1-yl]-4-oxobutyl]-6-nitro-1,3-benzoxazol-2-one |
| SMILES | Cc1ccc(C(=O)N2CCN(C(=O)CCCn3c(=O)oc4cc([N+](=O)[O-])ccc43)CC2)cc1 |
| InChI | InChI=1S/C23H24N4O6/c1-16-4-6-17(7-5-16)22(29)25-13-11-24(12-14-25)21(28)3-2-10-26-19-9-8-18(27(31)32)15-20(19)33-23(26)30/h4-9,15H,2-3,10-14H2,1H3 |
| InChIKey | OYWWTCVIACFBKP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 118.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|