C23H25N3O5 — CID 9204572
3-[4-(4-benzylpiperidin-1-yl)-4-oxobutyl]-6-nitro-1,3-benzoxazol-2-one (PubChem CID 9204572) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is 3-[4-(4-benzylpiperidin-1-yl)-4-oxobutyl]-6-nitro-1,3-benzoxazol-2-one.
| Compound Name | 3-[4-(4-benzylpiperidin-1-yl)-4-oxobutyl]-6-nitro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 9204572 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 3-[4-(4-benzylpiperidin-1-yl)-4-oxobutyl]-6-nitro-1,3-benzoxazol-2-one |
| SMILES | O=C(CCCn1c(=O)oc2cc([N+](=O)[O-])ccc21)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H25N3O5/c27-22(24-13-10-18(11-14-24)15-17-5-2-1-3-6-17)7-4-12-25-20-9-8-19(26(29)30)16-21(20)31-23(25)28/h1-3,5-6,8-9,16,18H,4,7,10-15H2 |
| InChIKey | GSMLEUYVSYQDPE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 98.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|