C15H21ClN4O5 — CID 119430855
N-[3-(methylamino)propyl]-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide;hydrochloride (PubChem CID 119430855) has the molecular formula C15H21ClN4O5 and a molecular weight of 372.81 g/mol. Its IUPAC name is N-[3-(methylamino)propyl]-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide;hydrochloride.
| Compound Name | N-[3-(methylamino)propyl]-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119430855 |
| Molecular Formula | C15H21ClN4O5 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | N-[3-(methylamino)propyl]-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide;hydrochloride |
| SMILES | CNCCCNC(=O)CCCn1c(=O)oc2cc([N+](=O)[O-])ccc21.Cl |
| InChI | InChI=1S/C15H20N4O5.ClH/c1-16-7-3-8-17-14(20)4-2-9-18-12-6-5-11(19(22)23)10-13(12)24-15(18)21;/h5-6,10,16H,2-4,7-9H2,1H3,(H,17,20);1H |
| InChIKey | MFQIFUHFHVDDJL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|