C14H17N3O5 — CID 78794436
2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-pentylacetamide (PubChem CID 78794436) has the molecular formula C14H17N3O5 and a molecular weight of 307.31 g/mol. Its IUPAC name is 2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-pentylacetamide.
| Compound Name | 2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-pentylacetamide |
|---|---|
| PubChem CID | 78794436 |
| Molecular Formula | C14H17N3O5 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-pentylacetamide |
| SMILES | CCCCCNC(=O)Cn1c(=O)oc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C14H17N3O5/c1-2-3-4-7-15-13(18)9-16-11-6-5-10(17(20)21)8-12(11)22-14(16)19/h5-6,8H,2-4,7,9H2,1H3,(H,15,18) |
| InChIKey | VGCBKRPECSMKEA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|