C16H19N3O5 — CID 9427764
N-[(1S,2R)-2-methylcyclohexyl]-2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetamide (PubChem CID 9427764) has the molecular formula C16H19N3O5 and a molecular weight of 333.34 g/mol. Its IUPAC name is N-[(1S,2R)-2-methylcyclohexyl]-2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetamide.
| Compound Name | N-[(1S,2R)-2-methylcyclohexyl]-2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 9427764 |
| Molecular Formula | C16H19N3O5 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | N-[(1S,2R)-2-methylcyclohexyl]-2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetamide |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=O)Cn1c(=O)oc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C16H19N3O5/c1-10-4-2-3-5-12(10)17-15(20)9-18-13-7-6-11(19(22)23)8-14(13)24-16(18)21/h6-8,10,12H,2-5,9H2,1H3,(H,17,20)/t10-,12+/m1/s1 |
| InChIKey | MXVQIEXPQIUFIV-PWSUYJOCSA-N |
| XLogP | 2.20 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|