C18H23N3O5 — CID 46612248
N-(2-methylcyclohexyl)-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide (PubChem CID 46612248) has the molecular formula C18H23N3O5 and a molecular weight of 361.40 g/mol. Its IUPAC name is N-(2-methylcyclohexyl)-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide.
| Compound Name | N-(2-methylcyclohexyl)-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide |
|---|---|
| PubChem CID | 46612248 |
| Molecular Formula | C18H23N3O5 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | N-(2-methylcyclohexyl)-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide |
| SMILES | CC1CCCCC1NC(=O)CCCn1c(=O)oc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C18H23N3O5/c1-12-5-2-3-6-14(12)19-17(22)7-4-10-20-15-9-8-13(21(24)25)11-16(15)26-18(20)23/h8-9,11-12,14H,2-7,10H2,1H3,(H,19,22) |
| InChIKey | WCCXDRCBNRXZFC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|