C14H18N4O5 — CID 120505501
N-[(2S)-1-aminopropan-2-yl]-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide (PubChem CID 120505501) has the molecular formula C14H18N4O5 and a molecular weight of 322.32 g/mol. Its IUPAC name is N-[(2S)-1-aminopropan-2-yl]-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide.
| Compound Name | N-[(2S)-1-aminopropan-2-yl]-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide |
|---|---|
| PubChem CID | 120505501 |
| Molecular Formula | C14H18N4O5 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | N-[(2S)-1-aminopropan-2-yl]-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide |
| SMILES | C[C@@H](CN)NC(=O)CCCn1c(=O)oc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C14H18N4O5/c1-9(8-15)16-13(19)3-2-6-17-11-5-4-10(18(21)22)7-12(11)23-14(17)20/h4-5,7,9H,2-3,6,8,15H2,1H3,(H,16,19)/t9-/m0/s1 |
| InChIKey | HGZCXUBNMMFZMU-VIFPVBQESA-N |
| XLogP | 0.75 |
| TPSA | 133.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|