C17H25ClN4O5 — CID 119666015
N-(1-aminohexan-2-yl)-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide;hydrochloride (PubChem CID 119666015) has the molecular formula C17H25ClN4O5 and a molecular weight of 400.86 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide;hydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119666015 |
| Molecular Formula | C17H25ClN4O5 |
| Molecular Weight | 400.86 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | N-(1-aminohexan-2-yl)-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide;hydrochloride |
| SMILES | CCCCC(CN)NC(=O)CCCn1c(=O)oc2cc([N+](=O)[O-])ccc21.Cl |
| InChI | InChI=1S/C17H24N4O5.ClH/c1-2-3-5-12(11-18)19-16(22)6-4-9-20-14-8-7-13(21(24)25)10-15(14)26-17(20)23;/h7-8,10,12H,2-6,9,11,18H2,1H3,(H,19,22);1H |
| InChIKey | MPFNGPSQESXFPX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 133.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.86 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|