C19H19N3O5 — CID 51210606
4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-(1-phenylethyl)butanamide (PubChem CID 51210606) has the molecular formula C19H19N3O5 and a molecular weight of 369.38 g/mol. Its IUPAC name is 4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-(1-phenylethyl)butanamide.
| Compound Name | 4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-(1-phenylethyl)butanamide |
|---|---|
| PubChem CID | 51210606 |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)-N-(1-phenylethyl)butanamide |
| SMILES | CC(NC(=O)CCCn1c(=O)oc2cc([N+](=O)[O-])ccc21)c1ccccc1 |
| InChI | InChI=1S/C19H19N3O5/c1-13(14-6-3-2-4-7-14)20-18(23)8-5-11-21-16-10-9-15(22(25)26)12-17(16)27-19(21)24/h2-4,6-7,9-10,12-13H,5,8,11H2,1H3,(H,20,23) |
| InChIKey | LQGKHOZAOZELDA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|