C17H23ClN4O5 — CID 119475770
N-(4-aminocyclohexyl)-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide;hydrochloride (PubChem CID 119475770) has the molecular formula C17H23ClN4O5 and a molecular weight of 398.85 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide;hydrochloride.
| Compound Name | N-(4-aminocyclohexyl)-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119475770 |
| Molecular Formula | C17H23ClN4O5 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | N-(4-aminocyclohexyl)-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide;hydrochloride |
| SMILES | Cl.NC1CCC(NC(=O)CCCn2c(=O)oc3cc([N+](=O)[O-])ccc32)CC1 |
| InChI | InChI=1S/C17H22N4O5.ClH/c18-11-3-5-12(6-4-11)19-16(22)2-1-9-20-14-8-7-13(21(24)25)10-15(14)26-17(20)23;/h7-8,10-12H,1-6,9,18H2,(H,19,22);1H |
| InChIKey | MGOWIIALNXDAEH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 133.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|