C18H25ClN4O5 — CID 119610183
N-[2-(aminomethyl)cyclohexyl]-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide;hydrochloride (PubChem CID 119610183) has the molecular formula C18H25ClN4O5 and a molecular weight of 412.87 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119610183 |
| Molecular Formula | C18H25ClN4O5 |
| Molecular Weight | 412.87 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide;hydrochloride |
| SMILES | Cl.NCC1CCCCC1NC(=O)CCCn1c(=O)oc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C18H24N4O5.ClH/c19-11-12-4-1-2-5-14(12)20-17(23)6-3-9-21-15-8-7-13(22(25)26)10-16(15)27-18(21)24;/h7-8,10,12,14H,1-6,9,11,19H2,(H,20,23);1H |
| InChIKey | XIVAGUPCUOFGJR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 133.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.87 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|