C17H21N3O8 — CID 55476281
[2-(1-methoxypropan-2-ylamino)-2-oxoethyl] 4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanoate (PubChem CID 55476281) has the molecular formula C17H21N3O8 and a molecular weight of 395.37 g/mol. Its IUPAC name is [2-(1-methoxypropan-2-ylamino)-2-oxoethyl] 4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanoate.
| Compound Name | [2-(1-methoxypropan-2-ylamino)-2-oxoethyl] 4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanoate |
|---|---|
| PubChem CID | 55476281 |
| Molecular Formula | C17H21N3O8 |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | [2-(1-methoxypropan-2-ylamino)-2-oxoethyl] 4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanoate |
| SMILES | COCC(C)NC(=O)COC(=O)CCCn1c(=O)oc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C17H21N3O8/c1-11(9-26-2)18-15(21)10-27-16(22)4-3-7-19-13-6-5-12(20(24)25)8-14(13)28-17(19)23/h5-6,8,11H,3-4,7,9-10H2,1-2H3,(H,18,21) |
| InChIKey | QOQUHOISFRNPLM-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|