C20H19BrN4O6 — CID 26369718
N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide (PubChem CID 26369718) has the molecular formula C20H19BrN4O6 and a molecular weight of 491.30 g/mol. Its IUPAC name is N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide.
| Compound Name | N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide |
|---|---|
| PubChem CID | 26369718 |
| Molecular Formula | C20H19BrN4O6 |
| Molecular Weight | 491.30 g/mol |
| Exact Mass | 490.05 |
| IUPAC Name | N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CNC(=O)CCCn1c(=O)oc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C20H19BrN4O6/c1-12-9-13(21)4-6-15(12)23-19(27)11-22-18(26)3-2-8-24-16-7-5-14(25(29)30)10-17(16)31-20(24)28/h4-7,9-10H,2-3,8,11H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | GQFSQOLIZWPZKU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 136.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|