C20H19ClN4O6 — CID 38956227
4-chloro-N,N-dimethyl-3-[4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanoylamino]benzamide (PubChem CID 38956227) has the molecular formula C20H19ClN4O6 and a molecular weight of 446.85 g/mol. Its IUPAC name is 4-chloro-N,N-dimethyl-3-[4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanoylamino]benzamide.
| Compound Name | 4-chloro-N,N-dimethyl-3-[4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanoylamino]benzamide |
|---|---|
| PubChem CID | 38956227 |
| Molecular Formula | C20H19ClN4O6 |
| Molecular Weight | 446.85 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 4-chloro-N,N-dimethyl-3-[4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanoylamino]benzamide |
| SMILES | CN(C)C(=O)c1ccc(Cl)c(NC(=O)CCCn2c(=O)oc3cc([N+](=O)[O-])ccc32)c1 |
| InChI | InChI=1S/C20H19ClN4O6/c1-23(2)19(27)12-5-7-14(21)15(10-12)22-18(26)4-3-9-24-16-8-6-13(25(29)30)11-17(16)31-20(24)28/h5-8,10-11H,3-4,9H2,1-2H3,(H,22,26) |
| InChIKey | CYJNEEAJYZDLNY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 127.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.85 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|