C25H22N4O7 — CID 27826809
N-(2-methoxyphenyl)-4-[4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanoylamino]benzamide (PubChem CID 27826809) has the molecular formula C25H22N4O7 and a molecular weight of 490.47 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-4-[4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanoylamino]benzamide.
| Compound Name | N-(2-methoxyphenyl)-4-[4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanoylamino]benzamide |
|---|---|
| PubChem CID | 27826809 |
| Molecular Formula | C25H22N4O7 |
| Molecular Weight | 490.47 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | N-(2-methoxyphenyl)-4-[4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanoylamino]benzamide |
| SMILES | COc1ccccc1NC(=O)c1ccc(NC(=O)CCCn2c(=O)oc3cc([N+](=O)[O-])ccc32)cc1 |
| InChI | InChI=1S/C25H22N4O7/c1-35-21-6-3-2-5-19(21)27-24(31)16-8-10-17(11-9-16)26-23(30)7-4-14-28-20-13-12-18(29(33)34)15-22(20)36-25(28)32/h2-3,5-6,8-13,15H,4,7,14H2,1H3,(H,26,30)(H,27,31) |
| InChIKey | HLBQEJXRFQYLFB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 145.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|