C17H15N5O5S — CID 55560369
N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide (PubChem CID 55560369) has the molecular formula C17H15N5O5S and a molecular weight of 401.40 g/mol. Its IUPAC name is N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide.
| Compound Name | N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide |
|---|---|
| PubChem CID | 55560369 |
| Molecular Formula | C17H15N5O5S |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide |
| SMILES | O=C(CCCn1c(=O)oc2cc([N+](=O)[O-])ccc21)NCc1cn2ccsc2n1 |
| InChI | InChI=1S/C17H15N5O5S/c23-15(18-9-11-10-20-6-7-28-16(20)19-11)2-1-5-21-13-4-3-12(22(25)26)8-14(13)27-17(21)24/h3-4,6-8,10H,1-2,5,9H2,(H,18,23) |
| InChIKey | AEBAFJYBRKKGNJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|