C16H14N4O7S — CID 18103777
methyl 2-[4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanoylamino]-1,3-thiazole-5-carboxylate (PubChem CID 18103777) has the molecular formula C16H14N4O7S and a molecular weight of 406.38 g/mol. Its IUPAC name is methyl 2-[4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanoylamino]-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanoylamino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 18103777 |
| Molecular Formula | C16H14N4O7S |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | methyl 2-[4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanoylamino]-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1cnc(NC(=O)CCCn2c(=O)oc3cc([N+](=O)[O-])ccc32)s1 |
| InChI | InChI=1S/C16H14N4O7S/c1-26-14(22)12-8-17-15(28-12)18-13(21)3-2-6-19-10-5-4-9(20(24)25)7-11(10)27-16(19)23/h4-5,7-8H,2-3,6H2,1H3,(H,17,18,21) |
| InChIKey | PONULWUHXYRNLX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 146.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|