C13H12F3N3O4S — CID 122625133
[4-oxo-4-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]butyl] carbamate (PubChem CID 122625133) has the molecular formula C13H12F3N3O4S and a molecular weight of 363.32 g/mol. Its IUPAC name is [4-oxo-4-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]butyl] carbamate.
| Compound Name | [4-oxo-4-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]butyl] carbamate |
|---|---|
| PubChem CID | 122625133 |
| Molecular Formula | C13H12F3N3O4S |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | [4-oxo-4-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]butyl] carbamate |
| SMILES | NC(=O)OCCCC(=O)Nc1nc2ccc(OC(F)(F)F)cc2s1 |
| InChI | InChI=1S/C13H12F3N3O4S/c14-13(15,16)23-7-3-4-8-9(6-7)24-12(18-8)19-10(20)2-1-5-22-11(17)21/h3-4,6H,1-2,5H2,(H2,17,21)(H,18,19,20) |
| InChIKey | SRCIQHSMKOTWHF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|