C12H7F3N2O4S — CID 171905318
4-oxo-4-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]but-2-enoic acid (PubChem CID 171905318) has the molecular formula C12H7F3N2O4S and a molecular weight of 332.26 g/mol. Its IUPAC name is 4-oxo-4-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]but-2-enoic acid.
| Compound Name | 4-oxo-4-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]but-2-enoic acid |
|---|---|
| PubChem CID | 171905318 |
| Molecular Formula | C12H7F3N2O4S |
| Molecular Weight | 332.26 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 4-oxo-4-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]but-2-enoic acid |
| SMILES | O=C(O)C=CC(=O)Nc1nc2ccc(OC(F)(F)F)cc2s1 |
| InChI | InChI=1S/C12H7F3N2O4S/c13-12(14,15)21-6-1-2-7-8(5-6)22-11(16-7)17-9(18)3-4-10(19)20/h1-5H,(H,19,20)(H,16,17,18) |
| InChIKey | XDXHCMBVUFIMSG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|