C18H23F3N4O3S — CID 122624911
2-amino-4-methyl-N-[4-oxo-4-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]butyl]pentanamide (PubChem CID 122624911) has the molecular formula C18H23F3N4O3S and a molecular weight of 432.47 g/mol. Its IUPAC name is 2-amino-4-methyl-N-[4-oxo-4-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]butyl]pentanamide.
| Compound Name | 2-amino-4-methyl-N-[4-oxo-4-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]butyl]pentanamide |
|---|---|
| PubChem CID | 122624911 |
| Molecular Formula | C18H23F3N4O3S |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 2-amino-4-methyl-N-[4-oxo-4-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]butyl]pentanamide |
| SMILES | CC(C)CC(N)C(=O)NCCCC(=O)Nc1nc2ccc(OC(F)(F)F)cc2s1 |
| InChI | InChI=1S/C18H23F3N4O3S/c1-10(2)8-12(22)16(27)23-7-3-4-15(26)25-17-24-13-6-5-11(9-14(13)29-17)28-18(19,20)21/h5-6,9-10,12H,3-4,7-8,22H2,1-2H3,(H,23,27)(H,24,25,26) |
| InChIKey | WZGIRLSXZSLASC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|