C22H24NO4P — CID 19700500
N-[4-(diethoxyphosphorylmethyl)phenyl]naphthalene-2-carboxamide (PubChem CID 19700500) has the molecular formula C22H24NO4P and a molecular weight of 397.41 g/mol. Its IUPAC name is N-[4-(diethoxyphosphorylmethyl)phenyl]naphthalene-2-carboxamide.
| Compound Name | N-[4-(diethoxyphosphorylmethyl)phenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 19700500 |
| Molecular Formula | C22H24NO4P |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | N-[4-(diethoxyphosphorylmethyl)phenyl]naphthalene-2-carboxamide |
| SMILES | CCOP(=O)(Cc1ccc(NC(=O)c2ccc3ccccc3c2)cc1)OCC |
| InChI | InChI=1S/C22H24NO4P/c1-3-26-28(25,27-4-2)16-17-9-13-21(14-10-17)23-22(24)20-12-11-18-7-5-6-8-19(18)15-20/h5-15H,3-4,16H2,1-2H3,(H,23,24) |
| InChIKey | ZVMSBIHQFGQOOG-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|