C19H23O5P — CID 168982141
prop-2-enyl 7-(diethoxyphosphorylmethyl)naphthalene-2-carboxylate (PubChem CID 168982141) has the molecular formula C19H23O5P and a molecular weight of 362.36 g/mol. Its IUPAC name is prop-2-enyl 7-(diethoxyphosphorylmethyl)naphthalene-2-carboxylate.
| Compound Name | prop-2-enyl 7-(diethoxyphosphorylmethyl)naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 168982141 |
| Molecular Formula | C19H23O5P |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | prop-2-enyl 7-(diethoxyphosphorylmethyl)naphthalene-2-carboxylate |
| SMILES | C=CCOC(=O)c1ccc2ccc(CP(=O)(OCC)OCC)cc2c1 |
| InChI | InChI=1S/C19H23O5P/c1-4-11-22-19(20)17-10-9-16-8-7-15(12-18(16)13-17)14-25(21,23-5-2)24-6-3/h4,7-10,12-13H,1,5-6,11,14H2,2-3H3 |
| InChIKey | ZOMHNFAXGUVNFT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|