C17H16O3 — CID 90322329
prop-2-enyl 6-hydroxy-5-prop-2-enylnaphthalene-2-carboxylate (PubChem CID 90322329) has the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. Its IUPAC name is prop-2-enyl 6-hydroxy-5-prop-2-enylnaphthalene-2-carboxylate.
| Compound Name | prop-2-enyl 6-hydroxy-5-prop-2-enylnaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 90322329 |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | prop-2-enyl 6-hydroxy-5-prop-2-enylnaphthalene-2-carboxylate |
| SMILES | C=CCOC(=O)c1ccc2c(CC=C)c(O)ccc2c1 |
| InChI | InChI=1S/C17H16O3/c1-3-5-15-14-8-6-13(17(19)20-10-4-2)11-12(14)7-9-16(15)18/h3-4,6-9,11,18H,1-2,5,10H2 |
| InChIKey | QHKMMVGCZMNXKR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|