C24H24N2O6 — CID 136778163
prop-2-enyl 4-hydroxy-3-[2-[(2-hydroxy-5-prop-2-enoxycarbonylphenyl)methylideneamino]ethyliminomethyl]benzoate (PubChem CID 136778163) has the molecular formula C24H24N2O6 and a molecular weight of 436.46 g/mol. Its IUPAC name is prop-2-enyl 4-hydroxy-3-[2-[(2-hydroxy-5-prop-2-enoxycarbonylphenyl)methylideneamino]ethyliminomethyl]benzoate.
| Compound Name | prop-2-enyl 4-hydroxy-3-[2-[(2-hydroxy-5-prop-2-enoxycarbonylphenyl)methylideneamino]ethyliminomethyl]benzoate |
|---|---|
| PubChem CID | 136778163 |
| Molecular Formula | C24H24N2O6 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | prop-2-enyl 4-hydroxy-3-[2-[(2-hydroxy-5-prop-2-enoxycarbonylphenyl)methylideneamino]ethyliminomethyl]benzoate |
| SMILES | C=CCOC(=O)c1ccc(O)c(/C=N/CC/N=C/c2cc(C(=O)OCC=C)ccc2O)c1 |
| InChI | InChI=1S/C24H24N2O6/c1-3-11-31-23(29)17-5-7-21(27)19(13-17)15-25-9-10-26-16-20-14-18(6-8-22(20)28)24(30)32-12-4-2/h3-8,13-16,27-28H,1-2,9-12H2/b25-15+,26-16+ |
| InChIKey | QRVZDNPJSPJVNK-RYQLWAFASA-N |
| XLogP | 3.32 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|