C18H16N2O6Zn — CID 140655476
3-[2-[(5-formyloxy-2-hydroxyphenyl)methylideneamino]ethyliminomethyl]-4-hydroxybenzoic acid;zinc (PubChem CID 140655476) has the molecular formula C18H16N2O6Zn and a molecular weight of 421.72 g/mol. Its IUPAC name is 3-[2-[(5-formyloxy-2-hydroxyphenyl)methylideneamino]ethyliminomethyl]-4-hydroxybenzoic acid;zinc.
| Compound Name | 3-[2-[(5-formyloxy-2-hydroxyphenyl)methylideneamino]ethyliminomethyl]-4-hydroxybenzoic acid;zinc |
|---|---|
| PubChem CID | 140655476 |
| Molecular Formula | C18H16N2O6Zn |
| Molecular Weight | 421.72 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | 3-[2-[(5-formyloxy-2-hydroxyphenyl)methylideneamino]ethyliminomethyl]-4-hydroxybenzoic acid;zinc |
| SMILES | O=COc1ccc(O)c(/C=N/CC/N=C/c2cc(C(=O)O)ccc2O)c1.[Zn] |
| InChI | InChI=1S/C18H16N2O6.Zn/c21-11-26-15-2-4-17(23)14(8-15)10-20-6-5-19-9-13-7-12(18(24)25)1-3-16(13)22;/h1-4,7-11,22-23H,5-6H2,(H,24,25);/b19-9+,20-10+; |
| InChIKey | WECRVDDYBCKXLW-HCURTGQUSA-N |
| XLogP | 1.87 |
| TPSA | 128.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.72 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|