C23H16O6 — CID 166589858
5-[(6-formyloxy-2-hydroxynaphthalen-1-yl)methyl]-6-hydroxynaphthalene-2-carboxylic acid (PubChem CID 166589858) has the molecular formula C23H16O6 and a molecular weight of 388.38 g/mol. Its IUPAC name is 5-[(6-formyloxy-2-hydroxynaphthalen-1-yl)methyl]-6-hydroxynaphthalene-2-carboxylic acid.
| Compound Name | 5-[(6-formyloxy-2-hydroxynaphthalen-1-yl)methyl]-6-hydroxynaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 166589858 |
| Molecular Formula | C23H16O6 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 5-[(6-formyloxy-2-hydroxynaphthalen-1-yl)methyl]-6-hydroxynaphthalene-2-carboxylic acid |
| SMILES | O=COc1ccc2c(Cc3c(O)ccc4cc(C(=O)O)ccc34)c(O)ccc2c1 |
| InChI | InChI=1S/C23H16O6/c24-12-29-16-4-6-18-14(10-16)3-8-22(26)20(18)11-19-17-5-1-15(23(27)28)9-13(17)2-7-21(19)25/h1-10,12,25-26H,11H2,(H,27,28) |
| InChIKey | IITZJTIFIYCGAL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|