C12H10Cl2O5 — CID 68837450
2-hydroxynaphthalene-1,6-dicarboxylic acid;dihydrochloride (PubChem CID 68837450) has the molecular formula C12H10Cl2O5 and a molecular weight of 305.11 g/mol. Its IUPAC name is 2-hydroxynaphthalene-1,6-dicarboxylic acid;dihydrochloride.
| Compound Name | 2-hydroxynaphthalene-1,6-dicarboxylic acid;dihydrochloride |
|---|---|
| PubChem CID | 68837450 |
| Molecular Formula | C12H10Cl2O5 |
| Molecular Weight | 305.11 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | 2-hydroxynaphthalene-1,6-dicarboxylic acid;dihydrochloride |
| SMILES | Cl.Cl.O=C(O)c1ccc2c(C(=O)O)c(O)ccc2c1 |
| InChI | InChI=1S/C12H8O5.2ClH/c13-9-4-2-6-5-7(11(14)15)1-3-8(6)10(9)12(16)17;;/h1-5,13H,(H,14,15)(H,16,17);2*1H |
| InChIKey | PRQJRAJVCTWRML-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.11 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |