C10H13NO2S — CID 137210775
4-methoxy-2-(2-sulfanylethyliminomethyl)phenol (PubChem CID 137210775) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is 4-methoxy-2-(2-sulfanylethyliminomethyl)phenol.
| Compound Name | 4-methoxy-2-(2-sulfanylethyliminomethyl)phenol |
|---|---|
| PubChem CID | 137210775 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 4-methoxy-2-(2-sulfanylethyliminomethyl)phenol |
| SMILES | COc1ccc(O)c(/C=N/CCS)c1 |
| InChI | InChI=1S/C10H13NO2S/c1-13-9-2-3-10(12)8(6-9)7-11-4-5-14/h2-3,6-7,12,14H,4-5H2,1H3/b11-7+ |
| InChIKey | IDIHQVBOUCAOAX-YRNVUSSQSA-N |
| XLogP | 1.75 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|