C17H16N2O2S — CID 135818099
2-[2-(1,3-benzothiazol-2-yl)ethyliminomethyl]-4-methoxyphenol (PubChem CID 135818099) has the molecular formula C17H16N2O2S and a molecular weight of 312.39 g/mol. Its IUPAC name is 2-[2-(1,3-benzothiazol-2-yl)ethyliminomethyl]-4-methoxyphenol.
| Compound Name | 2-[2-(1,3-benzothiazol-2-yl)ethyliminomethyl]-4-methoxyphenol |
|---|---|
| PubChem CID | 135818099 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 2-[2-(1,3-benzothiazol-2-yl)ethyliminomethyl]-4-methoxyphenol |
| SMILES | COc1ccc(O)c(/C=N/CCc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C17H16N2O2S/c1-21-13-6-7-15(20)12(10-13)11-18-9-8-17-19-14-4-2-3-5-16(14)22-17/h2-7,10-11,20H,8-9H2,1H3/b18-11+ |
| InChIKey | UCPKNPMZGZGDDO-WOJGMQOQSA-N |
| XLogP | 3.67 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|