C16H16BrNO2S — CID 135596106
2-[2-(4-bromophenyl)sulfanylethyliminomethyl]-4-methoxyphenol (PubChem CID 135596106) has the molecular formula C16H16BrNO2S and a molecular weight of 366.28 g/mol. Its IUPAC name is 2-[2-(4-bromophenyl)sulfanylethyliminomethyl]-4-methoxyphenol.
| Compound Name | 2-[2-(4-bromophenyl)sulfanylethyliminomethyl]-4-methoxyphenol |
|---|---|
| PubChem CID | 135596106 |
| Molecular Formula | C16H16BrNO2S |
| Molecular Weight | 366.28 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | 2-[2-(4-bromophenyl)sulfanylethyliminomethyl]-4-methoxyphenol |
| SMILES | COc1ccc(O)c(/C=N/CCSc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C16H16BrNO2S/c1-20-14-4-7-16(19)12(10-14)11-18-8-9-21-15-5-2-13(17)3-6-15/h2-7,10-11,19H,8-9H2,1H3/b18-11+ |
| InChIKey | WYBIWCYMMGFQPM-WOJGMQOQSA-N |
| XLogP | 4.37 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.28 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|