C22H26Br2N2O2 — CID 139081919
4-bromo-2-[8-[(5-bromo-2-hydroxyphenyl)methylideneamino]octyliminomethyl]phenol (PubChem CID 139081919) has the molecular formula C22H26Br2N2O2 and a molecular weight of 510.27 g/mol. Its IUPAC name is 4-bromo-2-[8-[(5-bromo-2-hydroxyphenyl)methylideneamino]octyliminomethyl]phenol.
| Compound Name | 4-bromo-2-[8-[(5-bromo-2-hydroxyphenyl)methylideneamino]octyliminomethyl]phenol |
|---|---|
| PubChem CID | 139081919 |
| Molecular Formula | C22H26Br2N2O2 |
| Molecular Weight | 510.27 g/mol |
| Exact Mass | 508.04 |
| IUPAC Name | 4-bromo-2-[8-[(5-bromo-2-hydroxyphenyl)methylideneamino]octyliminomethyl]phenol |
| SMILES | Oc1ccc(Br)cc1/C=N/CCCCCCCC/N=C/c1cc(Br)ccc1O |
| InChI | InChI=1S/C22H26Br2N2O2/c23-19-7-9-21(27)17(13-19)15-25-11-5-3-1-2-4-6-12-26-16-18-14-20(24)8-10-22(18)28/h7-10,13-16,27-28H,1-6,11-12H2/b25-15+,26-16+ |
| InChIKey | DZCOMEIZHVLCOH-RYQLWAFASA-N |
| XLogP | 6.50 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.27 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|