C18H18Cl2N2O2 — CID 136909314
4-chloro-2-[4-[(5-chloro-2-hydroxyphenyl)methylideneamino]butyliminomethyl]phenol (PubChem CID 136909314) has the molecular formula C18H18Cl2N2O2 and a molecular weight of 365.26 g/mol. Its IUPAC name is 4-chloro-2-[4-[(5-chloro-2-hydroxyphenyl)methylideneamino]butyliminomethyl]phenol.
| Compound Name | 4-chloro-2-[4-[(5-chloro-2-hydroxyphenyl)methylideneamino]butyliminomethyl]phenol |
|---|---|
| PubChem CID | 136909314 |
| Molecular Formula | C18H18Cl2N2O2 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 4-chloro-2-[4-[(5-chloro-2-hydroxyphenyl)methylideneamino]butyliminomethyl]phenol |
| SMILES | Oc1ccc(Cl)cc1/C=N/CCCC/N=C/c1cc(Cl)ccc1O |
| InChI | InChI=1S/C18H18Cl2N2O2/c19-15-3-5-17(23)13(9-15)11-21-7-1-2-8-22-12-14-10-16(20)4-6-18(14)24/h3-6,9-12,23-24H,1-2,7-8H2/b21-11+,22-12+ |
| InChIKey | AGJBXCFDMSVHSZ-XHQRYOPUSA-N |
| XLogP | 4.72 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|