C19H21ClN2O — CID 135829042
4-chloro-2-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyliminomethyl]phenol (PubChem CID 135829042) has the molecular formula C19H21ClN2O and a molecular weight of 328.84 g/mol. Its IUPAC name is 4-chloro-2-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyliminomethyl]phenol.
| Compound Name | 4-chloro-2-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyliminomethyl]phenol |
|---|---|
| PubChem CID | 135829042 |
| Molecular Formula | C19H21ClN2O |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 4-chloro-2-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyliminomethyl]phenol |
| SMILES | Oc1ccc(Cl)cc1/C=N/Cc1ccc(CN2CCCC2)cc1 |
| InChI | InChI=1S/C19H21ClN2O/c20-18-7-8-19(23)17(11-18)13-21-12-15-3-5-16(6-4-15)14-22-9-1-2-10-22/h3-8,11,13,23H,1-2,9-10,12,14H2/b21-13+ |
| InChIKey | KTYJVIAKTMXTGQ-FYJGNVAPSA-N |
| XLogP | 4.26 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|