C15H13BrFNO — CID 135758638
4-bromo-2-[2-(2-fluorophenyl)ethyliminomethyl]phenol (PubChem CID 135758638) has the molecular formula C15H13BrFNO and a molecular weight of 322.18 g/mol. Its IUPAC name is 4-bromo-2-[2-(2-fluorophenyl)ethyliminomethyl]phenol.
| Compound Name | 4-bromo-2-[2-(2-fluorophenyl)ethyliminomethyl]phenol |
|---|---|
| PubChem CID | 135758638 |
| Molecular Formula | C15H13BrFNO |
| Molecular Weight | 322.18 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 4-bromo-2-[2-(2-fluorophenyl)ethyliminomethyl]phenol |
| SMILES | Oc1ccc(Br)cc1/C=N/CCc1ccccc1F |
| InChI | InChI=1S/C15H13BrFNO/c16-13-5-6-15(19)12(9-13)10-18-8-7-11-3-1-2-4-14(11)17/h1-6,9-10,19H,7-8H2/b18-10+ |
| InChIKey | KRFMYYJFMBIYHL-VCHYOVAHSA-N |
| XLogP | 3.96 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.18 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|