C14H14BrN5O — CID 135690912
3-amino-5-[3-[(5-bromo-2-hydroxyphenyl)methylideneamino]propyl]-1H-pyrazole-4-carbonitrile (PubChem CID 135690912) has the molecular formula C14H14BrN5O and a molecular weight of 348.20 g/mol. Its IUPAC name is 3-amino-5-[3-[(5-bromo-2-hydroxyphenyl)methylideneamino]propyl]-1H-pyrazole-4-carbonitrile.
| Compound Name | 3-amino-5-[3-[(5-bromo-2-hydroxyphenyl)methylideneamino]propyl]-1H-pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 135690912 |
| Molecular Formula | C14H14BrN5O |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 3-amino-5-[3-[(5-bromo-2-hydroxyphenyl)methylideneamino]propyl]-1H-pyrazole-4-carbonitrile |
| SMILES | N#Cc1c(N)n[nH]c1CCC/N=C/c1cc(Br)ccc1O |
| InChI | InChI=1S/C14H14BrN5O/c15-10-3-4-13(21)9(6-10)8-18-5-1-2-12-11(7-16)14(17)20-19-12/h3-4,6,8,21H,1-2,5H2,(H3,17,19,20)/b18-8+ |
| InChIKey | QQIXHPFMDMXEFB-QGMBQPNBSA-N |
| XLogP | 2.38 |
| TPSA | 111.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|