C16H18N6O3 — CID 135690890
3-amino-5-[5-[(2-hydroxy-5-nitrophenyl)methylideneamino]pentyl]-1H-pyrazole-4-carbonitrile (PubChem CID 135690890) has the molecular formula C16H18N6O3 and a molecular weight of 342.36 g/mol. Its IUPAC name is 3-amino-5-[5-[(2-hydroxy-5-nitrophenyl)methylideneamino]pentyl]-1H-pyrazole-4-carbonitrile.
| Compound Name | 3-amino-5-[5-[(2-hydroxy-5-nitrophenyl)methylideneamino]pentyl]-1H-pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 135690890 |
| Molecular Formula | C16H18N6O3 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 3-amino-5-[5-[(2-hydroxy-5-nitrophenyl)methylideneamino]pentyl]-1H-pyrazole-4-carbonitrile |
| SMILES | N#Cc1c(N)n[nH]c1CCCCC/N=C/c1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C16H18N6O3/c17-9-13-14(20-21-16(13)18)4-2-1-3-7-19-10-11-8-12(22(24)25)5-6-15(11)23/h5-6,8,10,23H,1-4,7H2,(H3,18,20,21)/b19-10+ |
| InChIKey | TVHWSWMWKAKJCR-VXLYETTFSA-N |
| XLogP | 2.31 |
| TPSA | 154.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|