C8H6N6O3 — CID 135776103
4-nitro-2-(2H-tetrazol-5-yliminomethyl)phenol (PubChem CID 135776103) has the molecular formula C8H6N6O3 and a molecular weight of 234.18 g/mol. Its IUPAC name is 4-nitro-2-(2H-tetrazol-5-yliminomethyl)phenol.
| Compound Name | 4-nitro-2-(2H-tetrazol-5-yliminomethyl)phenol |
|---|---|
| PubChem CID | 135776103 |
| Molecular Formula | C8H6N6O3 |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 4-nitro-2-(2H-tetrazol-5-yliminomethyl)phenol |
| SMILES | O=[N+]([O-])c1ccc(O)c(C=Nc2nn[nH]n2)c1 |
| InChI | InChI=1S/C8H6N6O3/c15-7-2-1-6(14(16)17)3-5(7)4-9-8-10-12-13-11-8/h1-4,15H,(H,10,11,12,13) |
| InChIKey | SBWGREZBYUTATE-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 130.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|